(강하넷)
◈ 금지물질(제한물질) 및 관찰물질 CHECK LIST ◈ |
|||
㈜강하넷으로 납품하는 부품/재료에 아래 물질의 함유유무 및 제조하는 과정에서 사용유무를 표기하시오. (Yes, No) - 해당란에 ■ 표시. |
|||
|
|
Yes |
No |
카드뮴 및 화합물 |
Cadmium and compound |
□ |
■ |
납 및 화합물 |
Lead and compound |
□ |
■ |
수은 및 화합물 |
Mercury and compound |
□ |
■ |
6가 크롬 및 관련 물질 |
Hexavalent Chromium compound |
□ |
■ |
PBB |
Polybrominated biphenyls(PBBs) |
□ |
■ |
PBDE |
Polybrominated biphenyls ethers(PBDEs) |
□ |
■ |
안티몬 및 화합물 |
Antimony and its compounds |
□ |
■ |
비소 및 화합물 |
Arsenic and its compounds |
□ |
■ |
베릴륨 및 화합물 |
Beryllium and its compounds |
□ |
■ |
바륨 및 화합물 |
Barium and its compounds |
□ |
■ |
크롬 및 화합물(6가 크롬 제외) |
Chromium and its compounds |
□ |
■ |
코발트 및 화합물 |
Cobalt and its compounds |
□ |
■ |
망간 및 화합물 |
Manganese and its compounds |
□ |
■ |
유기주석 및 화합물 |
Organic-tin compounds |
□ |
■ |
셀렌 및 화합물 |
Selenium and its compounds |
□ |
■ |
텔루르 및 화합물 |
Tellurium and its compounds |
□ |
■ |
탈륨 및 화합물 |
Tallium and its compounds |
□ |
■ |
니켈 및 화합물 |
Nickel and its compounds |
□ |
■ |
시안화합물 |
Cyanides |
□ |
■ |
석면류 |
Asbestos etc. |
□ |
■ |
염화불화탄소 |
Chlorofluorocarbons(CFCs) |
□ |
■ |
수소화염화불화탄소 |
Hydrochlorofluorocarbons(HCFCs) |
□ |
■ |
하이드로프로로카본 |
Hydrofluorocarbons(HFCs) |
□ |
■ |
과불화화합물 |
Perfluorocarbons(PFCs) |
□ |
■ |
할론 |
Halons |
□ |
■ |
브롬화메틸 |
Methyl bromide |
□ |
■ |
염화파라핀 |
Chloroparaffins |
□ |
■ |
헥사크로로벤젠 |
Hexachlorobenzene |
□ |
■ |
폴리크로로테르페닐 |
Polychloroterphenyls(PCTs) |
□ |
■ |
염소화비페닐 |
Polychlorinated biphenyls(PCBs) |
□ |
■ |
염화비닐수지 |
Polyvinyl chloride(PVC) |
□ |
■ |
사염화탄소 |
Carbon tetrachloride |
□ |
■ |
1,1,1-트리클로로에탄 |
1,1,1-trichloroethane |
□ |
■ |
하이드로브로모플로로 카본 |
Hydrobromofluoro carbons(HBFCs) |
□ |
■ |
디크로로메탄 |
Dichloromethane |
□ |
■ |
디크로로에탄 |
Dichloroethane |
□ |
■ |
1,2-디크로로에탄 |
1,2-Dichloroethane |
□ |
■ |
1,2-디크로로에틸렌 |
1,2-Dichloromethane |
□ |
■ |
시스-1,2-디크로로에틸렌 |
Cis-1,2-dichloroethtlene |
□ |
■ |
1,2,2-트리크로로에탄 |
1,2,1-trichloroethane |
□ |
■ |
트리크로로엔틸렌 |
Trichloroethylene |
□ |
■ |
테트라크로로에틸렌 |
Tetrachloroethylene |
□ |
■ |
1,3-디클로프로펜 |
1,3-dichloropropene |
□ |
■ |
펜타크로로페놀 |
Pentachlorophenol |
□ |
■ |
에틸렌그리콜 모노에틸에테르 |
Ethylene glycol mono ethyl ether |
□ |
■ |
에틸렌그리콜 모노에틸에테르 아세트산 |
Ethylene glycol mono ethyl acetate |
□ |
■ |
에틸렌그리콜 모노메틸에테르 |
Ethylene glycol mono methyl ether |
□ |
■ |
에틸렌그리콜 모노메틸에테르 아세트산 |
Ethylene glycol mono methyl acetate |
□ |
■ |
아조염료 |
Azo dyes |
□ |
■ |
시안화합물 |
Cyanides |
□ |
■ |
벤젠 |
Benzene |
□ |
■ |
아크릴아미드 |
Acrylamide |
□ |
■ |
아크릴로 니트릴 |
Acronitrile |
□ |
■ |
Email : kangha@daum.net
'문서 및 자료 ★… > [업 무 양 식]' 카테고리의 다른 글
설비작업일지 (0) | 2021.03.09 |
---|---|
교정검사계획서 (0) | 2021.03.08 |
심사결과보고서 (0) | 2021.03.06 |
품질관리추진계획_사장님방침서 (0) | 2021.03.05 |
초도품보증서 (0) | 2021.03.04 |